C22H40O3Si — CID 162397723
trans-(1R,2S)-4,4-dimethyl-2-[(1R,3S)-1-methyl-2-oxo-3-tri(propan-2-yl)silyloxycyclobutyl]cyclopentane-1-carbaldehyde (PubChem CID 162397723) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is trans-(1R,2S)-4,4-dimethyl-2-[(1R,3S)-1-methyl-2-oxo-3-tri(propan-2-yl)silyloxycyclobutyl]cyclopentane-1-carbaldehyde.
| Compound Name | trans-(1R,2S)-4,4-dimethyl-2-[(1R,3S)-1-methyl-2-oxo-3-tri(propan-2-yl)silyloxycyclobutyl]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 162397723 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | trans-(1R,2S)-4,4-dimethyl-2-[(1R,3S)-1-methyl-2-oxo-3-tri(propan-2-yl)silyloxycyclobutyl]cyclopentane-1-carbaldehyde |
| SMILES | CC(C)[Si](O[C@H]1C[C@](C)([C@H]2CC(C)(C)C[C@H]2C=O)C1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H40O3Si/c1-14(2)26(15(3)4,16(5)6)25-19-12-22(9,20(19)24)18-11-21(7,8)10-17(18)13-23/h13-19H,10-12H2,1-9H3/t17-,18-,19-,22+/m0/s1 |
| InChIKey | OIBYMQHDOROMTC-ZVVDCOBXSA-N |
| XLogP | 5.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|