C22H33NO4Si — CID 162397866
(4S)-4-benzyl-3-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 162397866) has the molecular formula C22H33NO4Si and a molecular weight of 403.60 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 162397866 |
| Molecular Formula | C22H33NO4Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C/C=C/C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H33NO4Si/c1-17(27-28(5,6)22(2,3)4)11-10-14-20(24)23-19(16-26-21(23)25)15-18-12-8-7-9-13-18/h7-10,12-14,17,19H,11,15-16H2,1-6H3/b14-10+/t17-,19+/m1/s1 |
| InChIKey | IVGCHKCMIHXAGS-RIAACLELSA-N |
| XLogP | 4.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|