About (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene
(1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene (PubChem CID 162397904) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene.
Molecular Properties
| Compound Name | (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene |
| PubChem CID | 162397904 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene |
| SMILES | CCCC[C@@]12C=COC[C@@H]1C2(C)C |
| InChI | InChI=1S/C12H20O/c1-4-5-6-12-7-8-13-9-10(12)11(12,2)3/h7-8,10H,4-6,9H2,1-3H3/t10-,12-/m1/s1 |
| InChIKey | SFRBAOBLOUJOAM-ZYHUDNBSSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene?
The IUPAC name of (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene (CID 162397904) is (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene.
What is the SMILES notation for (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene?
The canonical SMILES for (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene is CCCC[C@@]12C=COC[C@@H]1C2(C)C.
What is the InChIKey of (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene?
The InChIKey is SFRBAOBLOUJOAM-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H20O/c1-4-5-6-12-7-8-13-9-10(12)11(12,2)3/h7-8,10H,4-6,9H2,1-3H3/t10-,12-/m1/s1.
What are the key properties of (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene?
(1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene has a molecular weight of 180.29 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-6-butyl-7,7-dimethyl-3-oxabicyclo[4.1.0]hept-4-ene is sourced from PubChem (CID 162397904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).