C21H24O5 — CID 162398074
ethyl (1'S,2'R,3S,5'S)-2-oxo-5'-(2-oxoethyl)-2'-propylspiro[1-benzofuran-3,6'-cyclohex-3-ene]-1'-carboxylate (PubChem CID 162398074) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is ethyl (1'S,2'R,3S,5'S)-2-oxo-5'-(2-oxoethyl)-2'-propylspiro[1-benzofuran-3,6'-cyclohex-3-ene]-1'-carboxylate.
| Compound Name | ethyl (1'S,2'R,3S,5'S)-2-oxo-5'-(2-oxoethyl)-2'-propylspiro[1-benzofuran-3,6'-cyclohex-3-ene]-1'-carboxylate |
|---|---|
| PubChem CID | 162398074 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | ethyl (1'S,2'R,3S,5'S)-2-oxo-5'-(2-oxoethyl)-2'-propylspiro[1-benzofuran-3,6'-cyclohex-3-ene]-1'-carboxylate |
| SMILES | CCC[C@@H]1C=C[C@H](CC=O)[C@]2(C(=O)Oc3ccccc32)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C21H24O5/c1-3-7-14-10-11-15(12-13-22)21(18(14)19(23)25-4-2)16-8-5-6-9-17(16)26-20(21)24/h5-6,8-11,13-15,18H,3-4,7,12H2,1-2H3/t14-,15-,18-,21-/m1/s1 |
| InChIKey | CKCCTJSOEZOEKX-GEPFMOHWSA-N |
| XLogP | 3.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|