About ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate
ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate (PubChem CID 162398157) has the molecular formula C24H20F2N2O2
and a molecular weight of 406.43 g/mol. Its IUPAC name is ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate |
| PubChem CID | 162398157 |
| Molecular Formula | C24H20F2N2O2 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cccc(-c2nc3ccccc3n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H20F2N2O2/c1-2-30-23(29)24(25,26)19-12-8-11-18(15-19)22-27-20-13-6-7-14-21(20)28(22)16-17-9-4-3-5-10-17/h3-15H,2,16H2,1H3 |
| InChIKey | JZYTYEWFZBHSFD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate?
The IUPAC name of ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate (CID 162398157) is ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate is CCOC(=O)C(F)(F)c1cccc(-c2nc3ccccc3n2Cc2ccccc2)c1.
What is the InChIKey of ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate?
The InChIKey is JZYTYEWFZBHSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F2N2O2/c1-2-30-23(29)24(25,26)19-12-8-11-18(15-19)22-27-20-13-6-7-14-21(20)28(22)16-17-9-4-3-5-10-17/h3-15H,2,16H2,1H3.
What are the key properties of ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate?
ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate has a molecular weight of 406.43 g/mol, XLogP of 5.41, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(1-benzylbenzimidazol-2-yl)phenyl]-2,2-difluoroacetate is sourced from PubChem (CID 162398157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).