About (4-fluorophenyl)sulfanyl selenocyanate
(4-fluorophenyl)sulfanyl selenocyanate (PubChem CID 162398186) has the molecular formula C7H4FNSSe
and a molecular weight of 232.14 g/mol. Its IUPAC name is (4-fluorophenyl)sulfanyl selenocyanate.
Molecular Properties
| Compound Name | (4-fluorophenyl)sulfanyl selenocyanate |
| PubChem CID | 162398186 |
| Molecular Formula | C7H4FNSSe |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.92 |
| IUPAC Name | (4-fluorophenyl)sulfanyl selenocyanate |
| SMILES | N#C[Se]Sc1ccc(F)cc1 |
| InChI | InChI=1S/C7H4FNSSe/c8-6-1-3-7(4-2-6)10-11-5-9/h1-4H |
| InChIKey | YNLKZERJEBCIHL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)sulfanyl selenocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)sulfanyl selenocyanate?
The IUPAC name of (4-fluorophenyl)sulfanyl selenocyanate (CID 162398186) is (4-fluorophenyl)sulfanyl selenocyanate.
What is the SMILES notation for (4-fluorophenyl)sulfanyl selenocyanate?
The canonical SMILES for (4-fluorophenyl)sulfanyl selenocyanate is N#C[Se]Sc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl)sulfanyl selenocyanate?
The InChIKey is YNLKZERJEBCIHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNSSe/c8-6-1-3-7(4-2-6)10-11-5-9/h1-4H.
What are the key properties of (4-fluorophenyl)sulfanyl selenocyanate?
(4-fluorophenyl)sulfanyl selenocyanate has a molecular weight of 232.14 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)sulfanyl selenocyanate is sourced from PubChem (CID 162398186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).