About [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene
[1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene (PubChem CID 162398192) has the molecular formula C16H18O4S
and a molecular weight of 306.38 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene.
Molecular Properties
| Compound Name | [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene |
| PubChem CID | 162398192 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene |
| SMILES | COC(OC)C(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O4S/c1-19-16(20-2)15(13-9-5-3-6-10-13)21(17,18)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3 |
| InChIKey | BOVBVCUUVQOQED-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene?
The IUPAC name of [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene (CID 162398192) is [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene.
What is the SMILES notation for [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene?
The canonical SMILES for [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene is COC(OC)C(c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene?
The InChIKey is BOVBVCUUVQOQED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O4S/c1-19-16(20-2)15(13-9-5-3-6-10-13)21(17,18)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3.
What are the key properties of [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene?
[1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene has a molecular weight of 306.38 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(benzenesulfonyl)-2,2-dimethoxyethyl]benzene is sourced from PubChem (CID 162398192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).