C29H17F5N2O — CID 162398337
2-(2,3,4,5,6-pentafluorophenyl)-3-(4-phenylmethoxyphenyl)-6-pyridin-2-ylpyridine (PubChem CID 162398337) has the molecular formula C29H17F5N2O and a molecular weight of 504.46 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-3-(4-phenylmethoxyphenyl)-6-pyridin-2-ylpyridine.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-3-(4-phenylmethoxyphenyl)-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 162398337 |
| Molecular Formula | C29H17F5N2O |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-3-(4-phenylmethoxyphenyl)-6-pyridin-2-ylpyridine |
| SMILES | Fc1c(F)c(F)c(-c2nc(-c3ccccn3)ccc2-c2ccc(OCc3ccccc3)cc2)c(F)c1F |
| InChI | InChI=1S/C29H17F5N2O/c30-24-23(25(31)27(33)28(34)26(24)32)29-20(13-14-22(36-29)21-8-4-5-15-35-21)18-9-11-19(12-10-18)37-16-17-6-2-1-3-7-17/h1-15H,16H2 |
| InChIKey | NIVYOUSGWQESQL-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|