C32H31F5N2O — CID 162398339
3-(4-decoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-6-pyridin-2-ylpyridine (PubChem CID 162398339) has the molecular formula C32H31F5N2O and a molecular weight of 554.60 g/mol. Its IUPAC name is 3-(4-decoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-6-pyridin-2-ylpyridine.
| Compound Name | 3-(4-decoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 162398339 |
| Molecular Formula | C32H31F5N2O |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 3-(4-decoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-6-pyridin-2-ylpyridine |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(-c3ccccn3)nc2-c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C32H31F5N2O/c1-2-3-4-5-6-7-8-11-20-40-22-15-13-21(14-16-22)23-17-18-25(24-12-9-10-19-38-24)39-32(23)26-27(33)29(35)31(37)30(36)28(26)34/h9-10,12-19H,2-8,11,20H2,1H3 |
| InChIKey | UXJMSGWOLTWOFW-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|