About ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate
ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate (PubChem CID 162398375) has the molecular formula C19H19F2NO4
and a molecular weight of 363.36 g/mol. Its IUPAC name is ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate.
Molecular Properties
| Compound Name | ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate |
| PubChem CID | 162398375 |
| Molecular Formula | C19H19F2NO4 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate |
| SMILES | CCOC(=O)C(F)(F)C[C@H](OC(C)=O)c1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C19H19F2NO4/c1-3-25-18(24)19(20,21)12-17(26-13(2)23)15-8-6-7-14(11-15)16-9-4-5-10-22-16/h4-11,17H,3,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | PZSBBWRDCRZLAP-KRWDZBQOSA-N |
| XLogP | 3.94 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate?
The IUPAC name of ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate (CID 162398375) is ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate.
What is the SMILES notation for ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate?
The canonical SMILES for ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate is CCOC(=O)C(F)(F)C[C@H](OC(C)=O)c1cccc(-c2ccccn2)c1.
What is the InChIKey of ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate?
The InChIKey is PZSBBWRDCRZLAP-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H19F2NO4/c1-3-25-18(24)19(20,21)12-17(26-13(2)23)15-8-6-7-14(11-15)16-9-4-5-10-22-16/h4-11,17H,3,12H2,1-2H3/t17-/m0/s1.
What are the key properties of ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate?
ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate has a molecular weight of 363.36 g/mol, XLogP of 3.94, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S)-4-acetyloxy-2,2-difluoro-4-(3-pyridin-2-ylphenyl)butanoate is sourced from PubChem (CID 162398375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).