About 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one
3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one (PubChem CID 162398700) has the molecular formula C23H20F3NO
and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one.
Molecular Properties
| Compound Name | 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one |
| PubChem CID | 162398700 |
| Molecular Formula | C23H20F3NO |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one |
| SMILES | CCCCC1=C(C(F)(F)F)C(=O)CC12C(c1ccccc1)=Nc1ccccc12 |
| InChI | InChI=1S/C23H20F3NO/c1-2-3-11-17-20(23(24,25)26)19(28)14-22(17)16-12-7-8-13-18(16)27-21(22)15-9-5-4-6-10-15/h4-10,12-13H,2-3,11,14H2,1H3 |
| InChIKey | GMRSKVCVBOZWHY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one?
The IUPAC name of 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one (CID 162398700) is 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one.
What is the SMILES notation for 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one?
The canonical SMILES for 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one is CCCCC1=C(C(F)(F)F)C(=O)CC12C(c1ccccc1)=Nc1ccccc12.
What is the InChIKey of 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one?
The InChIKey is GMRSKVCVBOZWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F3NO/c1-2-3-11-17-20(23(24,25)26)19(28)14-22(17)16-12-7-8-13-18(16)27-21(22)15-9-5-4-6-10-15/h4-10,12-13H,2-3,11,14H2,1H3.
What are the key properties of 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one?
3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one has a molecular weight of 383.41 g/mol, XLogP of 6.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2'-phenyl-2-(trifluoromethyl)spiro[cyclopent-2-ene-4,3'-indole]-1-one is sourced from PubChem (CID 162398700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).