About 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde
6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde (PubChem CID 162398860) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde |
| PubChem CID | 162398860 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde |
| SMILES | O=CC1=CC=CC=C([C@@H]2CCCC(=O)O2)C1 |
| InChI | InChI=1S/C13H14O3/c14-9-10-4-1-2-5-11(8-10)12-6-3-7-13(15)16-12/h1-2,4-5,9,12H,3,6-8H2/t12-/m0/s1 |
| InChIKey | MXDNENMGJGJTAR-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde?
The IUPAC name of 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde (CID 162398860) is 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde.
What is the SMILES notation for 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde?
The canonical SMILES for 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde is O=CC1=CC=CC=C([C@@H]2CCCC(=O)O2)C1.
What is the InChIKey of 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde?
The InChIKey is MXDNENMGJGJTAR-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H14O3/c14-9-10-4-1-2-5-11(8-10)12-6-3-7-13(15)16-12/h1-2,4-5,9,12H,3,6-8H2/t12-/m0/s1.
What are the key properties of 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde?
6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde has a molecular weight of 218.25 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2S)-6-oxooxan-2-yl]cyclohepta-1,3,5-triene-1-carbaldehyde is sourced from PubChem (CID 162398860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).