C18H24N2 — CID 162398909
10,10-dimethyl-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(11),12,14,16-tetraene (PubChem CID 162398909) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 10,10-dimethyl-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(11),12,14,16-tetraene.
| Compound Name | 10,10-dimethyl-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(11),12,14,16-tetraene |
|---|---|
| PubChem CID | 162398909 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 10,10-dimethyl-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(11),12,14,16-tetraene |
| SMILES | CC1(C)CN2CCCCCC2c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C18H24N2/c1-18(2)12-20-11-7-3-4-10-15(20)17-16(18)13-8-5-6-9-14(13)19-17/h5-6,8-9,15,19H,3-4,7,10-12H2,1-2H3 |
| InChIKey | GMNIBFZBNBVEAA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |