C23H20N2O2 — CID 162398925
(13S,13aS)-13-nitro-13a-phenyl-5,6,8,13-tetrahydroisoquinolino[2,1-b]isoquinoline (PubChem CID 162398925) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (13S,13aS)-13-nitro-13a-phenyl-5,6,8,13-tetrahydroisoquinolino[2,1-b]isoquinoline.
| Compound Name | (13S,13aS)-13-nitro-13a-phenyl-5,6,8,13-tetrahydroisoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 162398925 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (13S,13aS)-13-nitro-13a-phenyl-5,6,8,13-tetrahydroisoquinolino[2,1-b]isoquinoline |
| SMILES | O=[N+]([O-])[C@H]1c2ccccc2CN2CCc3ccccc3[C@@]12c1ccccc1 |
| InChI | InChI=1S/C23H20N2O2/c26-25(27)22-20-12-6-4-9-18(20)16-24-15-14-17-8-5-7-13-21(17)23(22,24)19-10-2-1-3-11-19/h1-13,22H,14-16H2/t22-,23-/m0/s1 |
| InChIKey | WOJDAQRRDZAEFO-GOTSBHOMSA-N |
| XLogP | 4.32 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|