About 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium
5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium (PubChem CID 162398939) has the molecular formula C12H12NS+
and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium |
| PubChem CID | 162398939 |
| Molecular Formula | C12H12NS+ |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium |
| SMILES | Cc1ccc(SC2C=C[CH+]N=C2)cc1 |
| InChI | InChI=1S/C12H12NS/c1-10-4-6-11(7-5-10)14-12-3-2-8-13-9-12/h2-9,12H,1H3/q+1 |
| InChIKey | AQRVKMFDXOIOMS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium?
The IUPAC name of 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium (CID 162398939) is 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium.
What is the SMILES notation for 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium?
The canonical SMILES for 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium is Cc1ccc(SC2C=C[CH+]N=C2)cc1.
What is the InChIKey of 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium?
The InChIKey is AQRVKMFDXOIOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12NS/c1-10-4-6-11(7-5-10)14-12-3-2-8-13-9-12/h2-9,12H,1H3/q+1.
What are the key properties of 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium?
5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium has a molecular weight of 202.30 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)sulfanyl-2,5-dihydropyridin-2-ylium is sourced from PubChem (CID 162398939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).