C20H19FO3S — CID 162398958
1-(4-fluorophenyl)-2-[3-(4-methylphenyl)sulfonyl-1-bicyclo[1.1.1]pentanyl]ethanone (PubChem CID 162398958) has the molecular formula C20H19FO3S and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[3-(4-methylphenyl)sulfonyl-1-bicyclo[1.1.1]pentanyl]ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[3-(4-methylphenyl)sulfonyl-1-bicyclo[1.1.1]pentanyl]ethanone |
|---|---|
| PubChem CID | 162398958 |
| Molecular Formula | C20H19FO3S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[3-(4-methylphenyl)sulfonyl-1-bicyclo[1.1.1]pentanyl]ethanone |
| SMILES | Cc1ccc(S(=O)(=O)C23CC(CC(=O)c4ccc(F)cc4)(C2)C3)cc1 |
| InChI | InChI=1S/C20H19FO3S/c1-14-2-8-17(9-3-14)25(23,24)20-11-19(12-20,13-20)10-18(22)15-4-6-16(21)7-5-15/h2-9H,10-13H2,1H3 |
| InChIKey | YEABZNXQSWDZCQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |