About ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate
ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate (PubChem CID 162398994) has the molecular formula C15H19F2NO3
and a molecular weight of 299.32 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate.
Molecular Properties
| Compound Name | ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate |
| PubChem CID | 162398994 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate |
| SMILES | CCOC(=O)C(F)(F)c1c(C)cc(/C(C)=N/OC)cc1C |
| InChI | InChI=1S/C15H19F2NO3/c1-6-21-14(19)15(16,17)13-9(2)7-12(8-10(13)3)11(4)18-20-5/h7-8H,6H2,1-5H3/b18-11+ |
| InChIKey | JIIFQUBAVVLAAT-WOJGMQOQSA-N |
| XLogP | 3.33 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate?
The IUPAC name of ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate (CID 162398994) is ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate.
What is the SMILES notation for ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate?
The canonical SMILES for ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate is CCOC(=O)C(F)(F)c1c(C)cc(/C(C)=N/OC)cc1C.
What is the InChIKey of ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate?
The InChIKey is JIIFQUBAVVLAAT-WOJGMQOQSA-N. The full InChI is InChI=1S/C15H19F2NO3/c1-6-21-14(19)15(16,17)13-9(2)7-12(8-10(13)3)11(4)18-20-5/h7-8H,6H2,1-5H3/b18-11+.
What are the key properties of ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate?
ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate has a molecular weight of 299.32 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-difluoro-2-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-2,6-dimethylphenyl]acetate is sourced from PubChem (CID 162398994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).