About 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene
1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene (PubChem CID 162399224) has the molecular formula C25H18OPd-4
and a molecular weight of 440.84 g/mol. Its IUPAC name is 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene.
Molecular Properties
| Compound Name | 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene |
| PubChem CID | 162399224 |
| Molecular Formula | C25H18OPd-4 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene |
| SMILES | COc1c[c-]c(-c2[c-]cccc2)cc1.[Pd].[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C13H10O.C12H8.Pd/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h2-5,7,9-10H,1H3;1-7,9H;/q2*-2; |
| InChIKey | ZGNWTIJKHGGDHR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene?
The IUPAC name of 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene (CID 162399224) is 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene.
What is the SMILES notation for 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene?
The canonical SMILES for 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene is COc1c[c-]c(-c2[c-]cccc2)cc1.[Pd].[c-]1ccccc1-c1[c-]cccc1.
What is the InChIKey of 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene?
The InChIKey is ZGNWTIJKHGGDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C12H8.Pd/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h2-5,7,9-10H,1H3;1-7,9H;/q2*-2;.
What are the key properties of 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene?
1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene has a molecular weight of 440.84 g/mol, XLogP of 5.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-phenylbenzene-5-ide;palladium;phenylbenzene is sourced from PubChem (CID 162399224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).