About 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile
4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile (PubChem CID 162399458) has the molecular formula C18H17NO3S2
and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile |
| PubChem CID | 162399458 |
| Molecular Formula | C18H17NO3S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile |
| SMILES | Cc1ccc(S(=O)(=O)C(C(=O)c2ccc(C#N)cc2)=S(C)C)cc1 |
| InChI | InChI=1S/C18H17NO3S2/c1-13-4-10-16(11-5-13)24(21,22)18(23(2)3)17(20)15-8-6-14(12-19)7-9-15/h4-11H,1-3H3 |
| InChIKey | MPEOXRPWYLZTKS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile?
The IUPAC name of 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile (CID 162399458) is 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile.
What is the SMILES notation for 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile?
The canonical SMILES for 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile is Cc1ccc(S(=O)(=O)C(C(=O)c2ccc(C#N)cc2)=S(C)C)cc1.
What is the InChIKey of 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile?
The InChIKey is MPEOXRPWYLZTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3S2/c1-13-4-10-16(11-5-13)24(21,22)18(23(2)3)17(20)15-8-6-14(12-19)7-9-15/h4-11H,1-3H3.
What are the key properties of 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile?
4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile has a molecular weight of 359.47 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(dimethyl-λ4-sulfanylidene)-2-(4-methylphenyl)sulfonylacetyl]benzonitrile is sourced from PubChem (CID 162399458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).