C23H28O3 — CID 162399519
(2S,5R)-2,4-diethyl-2,4-diphenyl-5-propan-2-yloxyoxolan-3-one (PubChem CID 162399519) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (2S,5R)-2,4-diethyl-2,4-diphenyl-5-propan-2-yloxyoxolan-3-one.
| Compound Name | (2S,5R)-2,4-diethyl-2,4-diphenyl-5-propan-2-yloxyoxolan-3-one |
|---|---|
| PubChem CID | 162399519 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (2S,5R)-2,4-diethyl-2,4-diphenyl-5-propan-2-yloxyoxolan-3-one |
| SMILES | CCC1(c2ccccc2)C(=O)[C@](CC)(c2ccccc2)O[C@H]1OC(C)C |
| InChI | InChI=1S/C23H28O3/c1-5-22(18-13-9-7-10-14-18)20(24)23(6-2,19-15-11-8-12-16-19)26-21(22)25-17(3)4/h7-17,21H,5-6H2,1-4H3/t21-,22?,23+/m1/s1 |
| InChIKey | YNBCGAHHQGRNIW-CTDXOEGXSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |