C16H20O2 — CID 162399957
(2R,6S)-2,6-dimethyl-15-oxatetracyclo[7.4.1.110,13.02,7]pentadeca-7,11-dien-14-one (PubChem CID 162399957) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-15-oxatetracyclo[7.4.1.110,13.02,7]pentadeca-7,11-dien-14-one.
| Compound Name | (2R,6S)-2,6-dimethyl-15-oxatetracyclo[7.4.1.110,13.02,7]pentadeca-7,11-dien-14-one |
|---|---|
| PubChem CID | 162399957 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-15-oxatetracyclo[7.4.1.110,13.02,7]pentadeca-7,11-dien-14-one |
| SMILES | C[C@H]1CCC[C@@]2(C)C1=CC1C(=O)C2C2C=CC1O2 |
| InChI | InChI=1S/C16H20O2/c1-9-4-3-7-16(2)11(9)8-10-12-5-6-13(18-12)14(16)15(10)17/h5-6,8-10,12-14H,3-4,7H2,1-2H3/t9-,10?,12?,13?,14?,16-/m0/s1 |
| InChIKey | RIBLDUYBXGJHDX-NAMWRFDZSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|