C9H16F2N+ — CID 162399995
1-(3,3-difluoroprop-2-enyl)-1-methylpiperidin-1-ium (PubChem CID 162399995) has the molecular formula C9H16F2N+ and a molecular weight of 176.23 g/mol. Its IUPAC name is 1-(3,3-difluoroprop-2-enyl)-1-methylpiperidin-1-ium.
| Compound Name | 1-(3,3-difluoroprop-2-enyl)-1-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 162399995 |
| Molecular Formula | C9H16F2N+ |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-(3,3-difluoroprop-2-enyl)-1-methylpiperidin-1-ium |
| SMILES | C[N+]1(CC=C(F)F)CCCCC1 |
| InChI | InChI=1S/C9H16F2N/c1-12(8-5-9(10)11)6-3-2-4-7-12/h5H,2-4,6-8H2,1H3/q+1 |
| InChIKey | UQUUXGOIVNUGLX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|