About phenylmethylideneazanide;ruthenium(2+)
phenylmethylideneazanide;ruthenium(2+) (PubChem CID 162400041) has the molecular formula C7H5NRu
and a molecular weight of 204.19 g/mol. Its IUPAC name is phenylmethylideneazanide;ruthenium(2+).
Molecular Properties
| Compound Name | phenylmethylideneazanide;ruthenium(2+) |
| PubChem CID | 162400041 |
| Molecular Formula | C7H5NRu |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.95 |
| IUPAC Name | phenylmethylideneazanide;ruthenium(2+) |
| SMILES | [N-]=Cc1[c-]cccc1.[Ru+2] |
| InChI | InChI=1S/C7H5N.Ru/c8-6-7-4-2-1-3-5-7;/h1-4,6H;/q-2;+2 |
| InChIKey | UHLSCNAHMTUNCL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze phenylmethylideneazanide;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethylideneazanide;ruthenium(2+)?
The IUPAC name of phenylmethylideneazanide;ruthenium(2+) (CID 162400041) is phenylmethylideneazanide;ruthenium(2+).
What is the SMILES notation for phenylmethylideneazanide;ruthenium(2+)?
The canonical SMILES for phenylmethylideneazanide;ruthenium(2+) is [N-]=Cc1[c-]cccc1.[Ru+2].
What is the InChIKey of phenylmethylideneazanide;ruthenium(2+)?
The InChIKey is UHLSCNAHMTUNCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N.Ru/c8-6-7-4-2-1-3-5-7;/h1-4,6H;/q-2;+2.
What are the key properties of phenylmethylideneazanide;ruthenium(2+)?
phenylmethylideneazanide;ruthenium(2+) has a molecular weight of 204.19 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethylideneazanide;ruthenium(2+) is sourced from PubChem (CID 162400041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).