About (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one
(4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one (PubChem CID 162400114) has the molecular formula C14H26O4Si
and a molecular weight of 286.44 g/mol. Its IUPAC name is (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one.
Molecular Properties
| Compound Name | (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one |
| PubChem CID | 162400114 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)OC[C@H]1[C@@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-9-11(8-17-13(9)16)12(15)10(2)18-19(6,7)14(3,4)5/h10-12,15H,1,8H2,2-7H3/t10-,11-,12+/m1/s1 |
| InChIKey | FWQSIQJYMXMLHE-UTUOFQBUSA-N |
| XLogP | 2.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one?
The IUPAC name of (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one (CID 162400114) is (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one.
What is the SMILES notation for (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one?
The canonical SMILES for (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one is C=C1C(=O)OC[C@H]1[C@@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one?
The InChIKey is FWQSIQJYMXMLHE-UTUOFQBUSA-N. The full InChI is InChI=1S/C14H26O4Si/c1-9-11(8-17-13(9)16)12(15)10(2)18-19(6,7)14(3,4)5/h10-12,15H,1,8H2,2-7H3/t10-,11-,12+/m1/s1.
What are the key properties of (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one?
(4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one has a molecular weight of 286.44 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-3-methylideneoxolan-2-one is sourced from PubChem (CID 162400114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).