C18H28O6Si — CID 162400115
(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(1S)-1-hydroxy-2-(5-oxo-2H-furan-3-yl)ethyl]-3-methylideneoxolan-2-one (PubChem CID 162400115) has the molecular formula C18H28O6Si and a molecular weight of 368.50 g/mol. Its IUPAC name is (4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(1S)-1-hydroxy-2-(5-oxo-2H-furan-3-yl)ethyl]-3-methylideneoxolan-2-one.
| Compound Name | (4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(1S)-1-hydroxy-2-(5-oxo-2H-furan-3-yl)ethyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 162400115 |
| Molecular Formula | C18H28O6Si |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(1S)-1-hydroxy-2-(5-oxo-2H-furan-3-yl)ethyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1[C@@H](O)CC1=CC(=O)OC1 |
| InChI | InChI=1S/C18H28O6Si/c1-11-16(13(19)7-12-8-15(20)22-9-12)14(24-17(11)21)10-23-25(5,6)18(2,3)4/h8,13-14,16,19H,1,7,9-10H2,2-6H3/t13-,14+,16+/m0/s1 |
| InChIKey | ZJNKXXTTWIHLBS-SQWLQELKSA-N |
| XLogP | 2.34 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|