About N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide
N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide (PubChem CID 162400164) has the molecular formula C13H15NO4S
and a molecular weight of 281.33 g/mol. Its IUPAC name is N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide.
Molecular Properties
| Compound Name | N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide |
| PubChem CID | 162400164 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide |
| SMILES | O=C(NS(=O)(=O)Cc1ccccc1)C1=COCCC1 |
| InChI | InChI=1S/C13H15NO4S/c15-13(12-7-4-8-18-9-12)14-19(16,17)10-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2,(H,14,15) |
| InChIKey | MWCFSQJLNUOEAM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide?
The IUPAC name of N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide (CID 162400164) is N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide.
What is the SMILES notation for N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide?
The canonical SMILES for N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide is O=C(NS(=O)(=O)Cc1ccccc1)C1=COCCC1.
What is the InChIKey of N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide?
The InChIKey is MWCFSQJLNUOEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4S/c15-13(12-7-4-8-18-9-12)14-19(16,17)10-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2,(H,14,15).
What are the key properties of N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide?
N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide has a molecular weight of 281.33 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylsulfonyl-3,4-dihydro-2H-pyran-5-carboxamide is sourced from PubChem (CID 162400164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).