C30H24F6O4 — CID 162400464
1,2-bis(4-methoxyphenyl)-1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diol (PubChem CID 162400464) has the molecular formula C30H24F6O4 and a molecular weight of 562.51 g/mol. Its IUPAC name is 1,2-bis(4-methoxyphenyl)-1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diol.
| Compound Name | 1,2-bis(4-methoxyphenyl)-1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 162400464 |
| Molecular Formula | C30H24F6O4 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)-1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diol |
| SMILES | COc1ccc(C(O)(c2ccc(C(F)(F)F)cc2)C(O)(c2ccc(OC)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H24F6O4/c1-39-25-15-11-21(12-16-25)27(37,19-3-7-23(8-4-19)29(31,32)33)28(38,22-13-17-26(40-2)18-14-22)20-5-9-24(10-6-20)30(34,35)36/h3-18,37-38H,1-2H3 |
| InChIKey | BGXZIUXFCIQHOB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |