About tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate
tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate (PubChem CID 162400517) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate.
Molecular Properties
| Compound Name | tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate |
| PubChem CID | 162400517 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C13H22O4/c1-12(2,3)17-11(14)7-6-10-8-9-15-13(4,5)16-10/h6-7,10H,8-9H2,1-5H3/b7-6+/t10-/m1/s1 |
| InChIKey | AUFHNMRXUPONIE-VQCYPWCPSA-N |
| XLogP | 2.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate?
The IUPAC name of tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate (CID 162400517) is tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate.
What is the SMILES notation for tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate?
The canonical SMILES for tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate is CC(C)(C)OC(=O)/C=C/[C@@H]1CCOC(C)(C)O1.
What is the InChIKey of tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate?
The InChIKey is AUFHNMRXUPONIE-VQCYPWCPSA-N. The full InChI is InChI=1S/C13H22O4/c1-12(2,3)17-11(14)7-6-10-8-9-15-13(4,5)16-10/h6-7,10H,8-9H2,1-5H3/b7-6+/t10-/m1/s1.
What are the key properties of tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate?
tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate has a molecular weight of 242.31 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enoate is sourced from PubChem (CID 162400517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).