About diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate
diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate (PubChem CID 162400624) has the molecular formula C25H27Br2NO5
and a molecular weight of 581.30 g/mol. Its IUPAC name is diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate |
| PubChem CID | 162400624 |
| Molecular Formula | C25H27Br2NO5 |
| Molecular Weight | 581.30 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1C(=O)N(Cc2ccccc2)C[C@H]1C(Br)(Br)c1ccccc1 |
| InChI | InChI=1S/C25H27Br2NO5/c1-3-32-23(30)21(24(31)33-4-2)20-19(25(26,27)18-13-9-6-10-14-18)16-28(22(20)29)15-17-11-7-5-8-12-17/h5-14,19-21H,3-4,15-16H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | IKWLWORHNLBION-WOJBJXKFSA-N |
| XLogP | 4.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 581.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate?
The IUPAC name of diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate (CID 162400624) is diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate.
What is the SMILES notation for diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate?
The canonical SMILES for diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate is CCOC(=O)C(C(=O)OCC)[C@@H]1C(=O)N(Cc2ccccc2)C[C@H]1C(Br)(Br)c1ccccc1.
What is the InChIKey of diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate?
The InChIKey is IKWLWORHNLBION-WOJBJXKFSA-N. The full InChI is InChI=1S/C25H27Br2NO5/c1-3-32-23(30)21(24(31)33-4-2)20-19(25(26,27)18-13-9-6-10-14-18)16-28(22(20)29)15-17-11-7-5-8-12-17/h5-14,19-21H,3-4,15-16H2,1-2H3/t19-,20-/m1/s1.
What are the key properties of diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate?
diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate has a molecular weight of 581.30 g/mol, XLogP of 4.65, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(3S,4S)-1-benzyl-4-[dibromo(phenyl)methyl]-2-oxopyrrolidin-3-yl]propanedioate is sourced from PubChem (CID 162400624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).