C10H16O2 — CID 162400652
(7aS)-3-propan-2-ylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran (PubChem CID 162400652) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (7aS)-3-propan-2-ylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran.
| Compound Name | (7aS)-3-propan-2-ylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
|---|---|
| PubChem CID | 162400652 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (7aS)-3-propan-2-ylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
| SMILES | CC(C)=C1CO[C@@H]2OCCCC12 |
| InChI | InChI=1S/C10H16O2/c1-7(2)9-6-12-10-8(9)4-3-5-11-10/h8,10H,3-6H2,1-2H3/t8?,10-/m0/s1 |
| InChIKey | DFIAFQNVBGKRMO-HTLJXXAVSA-N |
| XLogP | 2.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|