C20H30 — CID 162400655
(10S,11S)-10-ethynyl-7,11-dimethylhexadeca-1,6-dien-14-yne (PubChem CID 162400655) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is (10S,11S)-10-ethynyl-7,11-dimethylhexadeca-1,6-dien-14-yne.
| Compound Name | (10S,11S)-10-ethynyl-7,11-dimethylhexadeca-1,6-dien-14-yne |
|---|---|
| PubChem CID | 162400655 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (10S,11S)-10-ethynyl-7,11-dimethylhexadeca-1,6-dien-14-yne |
| SMILES | C#C[C@@H](CCC(C)=CCCCC=C)[C@@H](C)CCC#CC |
| InChI | InChI=1S/C20H30/c1-6-9-11-13-14-18(4)16-17-20(8-3)19(5)15-12-10-7-2/h3,6,14,19-20H,1,9,11-13,15-17H2,2,4-5H3/t19-,20-/m0/s1 |
| InChIKey | ZMELKGFDEPBNFZ-PMACEKPBSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|