C14H19F3O4 — CID 162400790
diethyl 3-methylidene-4-(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 162400790) has the molecular formula C14H19F3O4 and a molecular weight of 308.30 g/mol. Its IUPAC name is diethyl 3-methylidene-4-(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-methylidene-4-(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 162400790 |
| Molecular Formula | C14H19F3O4 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | diethyl 3-methylidene-4-(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)CC1CC(F)(F)F |
| InChI | InChI=1S/C14H19F3O4/c1-4-20-11(18)13(12(19)21-5-2)6-9(3)10(7-13)8-14(15,16)17/h10H,3-8H2,1-2H3 |
| InChIKey | BWIXWZBHFJMBKU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|