C18H22O2 — CID 162401024
(3aS,4S,6aR)-3,3,6a-trimethyl-4-[(E)-2-phenylethenyl]-3a,4,5,6-tetrahydrocyclopenta[c]furan-1-one (PubChem CID 162401024) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (3aS,4S,6aR)-3,3,6a-trimethyl-4-[(E)-2-phenylethenyl]-3a,4,5,6-tetrahydrocyclopenta[c]furan-1-one.
| Compound Name | (3aS,4S,6aR)-3,3,6a-trimethyl-4-[(E)-2-phenylethenyl]-3a,4,5,6-tetrahydrocyclopenta[c]furan-1-one |
|---|---|
| PubChem CID | 162401024 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (3aS,4S,6aR)-3,3,6a-trimethyl-4-[(E)-2-phenylethenyl]-3a,4,5,6-tetrahydrocyclopenta[c]furan-1-one |
| SMILES | CC1(C)OC(=O)[C@]2(C)CC[C@@H](/C=C/c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C18H22O2/c1-17(2)15-14(10-9-13-7-5-4-6-8-13)11-12-18(15,3)16(19)20-17/h4-10,14-15H,11-12H2,1-3H3/b10-9+/t14-,15-,18-/m1/s1 |
| InChIKey | ZLMDZXGRBLLASL-CCKNDOKRSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |