About cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate
cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate (PubChem CID 162401040) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate |
| PubChem CID | 162401040 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@@H]1NC(C)=O |
| InChI | InChI=1S/C11H19NO3/c1-3-15-11(14)9-6-4-5-7-10(9)12-8(2)13/h9-10H,3-7H2,1-2H3,(H,12,13)/t9-,10+/m1/s1 |
| InChIKey | COSAQTQNNIICHJ-ZJUUUORDSA-N |
| XLogP | 1.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate?
The IUPAC name of cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate (CID 162401040) is cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate?
The canonical SMILES for cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate is CCOC(=O)[C@@H]1CCCC[C@@H]1NC(C)=O.
What is the InChIKey of cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate?
The InChIKey is COSAQTQNNIICHJ-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H19NO3/c1-3-15-11(14)9-6-4-5-7-10(9)12-8(2)13/h9-10H,3-7H2,1-2H3,(H,12,13)/t9-,10+/m1/s1.
What are the key properties of cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate?
cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1R,2S)-2-acetamidocyclohexane-1-carboxylate is sourced from PubChem (CID 162401040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).