C13H12O4 — CID 162401089
ethyl 1,4-dioxo-2,3-dihydronaphthalene-2-carboxylate (PubChem CID 162401089) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is ethyl 1,4-dioxo-2,3-dihydronaphthalene-2-carboxylate.
| Compound Name | ethyl 1,4-dioxo-2,3-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 162401089 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | ethyl 1,4-dioxo-2,3-dihydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)C1CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H12O4/c1-2-17-13(16)10-7-11(14)8-5-3-4-6-9(8)12(10)15/h3-6,10H,2,7H2,1H3 |
| InChIKey | IZAWJTCIDRYKIL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|