About [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate
[(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate (PubChem CID 162401106) has the molecular formula C14H17F3O3S
and a molecular weight of 322.35 g/mol. Its IUPAC name is [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate |
| PubChem CID | 162401106 |
| Molecular Formula | C14H17F3O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC/C=C/C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O3S/c1-12-6-8-13(9-7-12)21(18,19)20-11-5-3-2-4-10-14(15,16)17/h4,6-10H,2-3,5,11H2,1H3/b10-4+ |
| InChIKey | MVUVJGBDWRYDGZ-ONNFQVAWSA-N |
| XLogP | 3.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate?
The IUPAC name of [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate (CID 162401106) is [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCC/C=C/C(F)(F)F)cc1.
What is the InChIKey of [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate?
The InChIKey is MVUVJGBDWRYDGZ-ONNFQVAWSA-N. The full InChI is InChI=1S/C14H17F3O3S/c1-12-6-8-13(9-7-12)21(18,19)20-11-5-3-2-4-10-14(15,16)17/h4,6-10H,2-3,5,11H2,1H3/b10-4+.
What are the key properties of [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate?
[(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate has a molecular weight of 322.35 g/mol, XLogP of 3.99, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-7,7,7-trifluorohept-5-enyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 162401106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).