C25H42O5Si — CID 162401107
3-[(3aR,5R,6R,6aR)-6-[(Z)-but-2-enyl]-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]hept-6-en-1-yn-3-yloxy-triethylsilane (PubChem CID 162401107) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is 3-[(3aR,5R,6R,6aR)-6-[(Z)-but-2-enyl]-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]hept-6-en-1-yn-3-yloxy-triethylsilane.
| Compound Name | 3-[(3aR,5R,6R,6aR)-6-[(Z)-but-2-enyl]-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]hept-6-en-1-yn-3-yloxy-triethylsilane |
|---|---|
| PubChem CID | 162401107 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 3-[(3aR,5R,6R,6aR)-6-[(Z)-but-2-enyl]-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]hept-6-en-1-yn-3-yloxy-triethylsilane |
| SMILES | C#CC(CCC=C)(O[Si](CC)(CC)CC)[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@]1(C/C=C\C)OC |
| InChI | InChI=1S/C25H42O5Si/c1-10-16-18-24(12-3,30-31(13-4,14-5)15-6)22-25(26-9,19-17-11-2)20-21(27-22)29-23(7,8)28-20/h3,10-11,17,20-22H,1,13-16,18-19H2,2,4-9H3/b17-11-/t20-,21+,22-,24?,25-/m0/s1 |
| InChIKey | PBWAZVYUKNTVPM-STXYODIOSA-N |
| XLogP | 5.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|