C15H26O4 — CID 162401199
tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-prop-1-en-2-yl-1,3-dioxan-4-yl]acetate (PubChem CID 162401199) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-prop-1-en-2-yl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-prop-1-en-2-yl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 162401199 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-prop-1-en-2-yl-1,3-dioxan-4-yl]acetate |
| SMILES | C=C(C)[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C15H26O4/c1-10(2)12-8-11(17-15(6,7)18-12)9-13(16)19-14(3,4)5/h11-12H,1,8-9H2,2-7H3/t11-,12+/m1/s1 |
| InChIKey | FREMUJMTAQZEAG-NEPJUHHUSA-N |
| XLogP | 3.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|