C8H8F3NO3S — CID 162401320
3-methylsulfonyl-5-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 162401320) has the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. Its IUPAC name is 3-methylsulfonyl-5-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 3-methylsulfonyl-5-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 162401320 |
| Molecular Formula | C8H8F3NO3S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 3-methylsulfonyl-5-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | CS(=O)(=O)c1cncc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C8H8F3NO3S/c1-16(13,14)7-2-6(3-12-4-7)15-5-8(9,10)11/h2-4H,5H2,1H3 |
| InChIKey | MWORJDVUZOTNDD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |