C12H22NO+ — CID 162401354
(4aS,7R,8aR)-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-3-ium (PubChem CID 162401354) has the molecular formula C12H22NO+ and a molecular weight of 196.31 g/mol. Its IUPAC name is (4aS,7R,8aR)-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-3-ium.
| Compound Name | (4aS,7R,8aR)-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 162401354 |
| Molecular Formula | C12H22NO+ |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | (4aS,7R,8aR)-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-1,3-benzoxazin-3-ium |
| SMILES | CC1=[NH+]C(C)(C)[C@@H]2CC[C@@H](C)C[C@H]2O1 |
| InChI | InChI=1S/C12H21NO/c1-8-5-6-10-11(7-8)14-9(2)13-12(10,3)4/h8,10-11H,5-7H2,1-4H3/p+1/t8-,10-,11-/m1/s1 |
| InChIKey | LQCDMDCZVVVXFB-FBIMIBRVSA-O |
| XLogP | 1.10 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |