C8H15NO2 — CID 162401416
N-[(3S,4S)-3-methyloxan-4-yl]acetamide (PubChem CID 162401416) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is N-[(3S,4S)-3-methyloxan-4-yl]acetamide.
| Compound Name | N-[(3S,4S)-3-methyloxan-4-yl]acetamide |
|---|---|
| PubChem CID | 162401416 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N-[(3S,4S)-3-methyloxan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CCOC[C@H]1C |
| InChI | InChI=1S/C8H15NO2/c1-6-5-11-4-3-8(6)9-7(2)10/h6,8H,3-5H2,1-2H3,(H,9,10)/t6-,8+/m1/s1 |
| InChIKey | BDZDWWJYDOWRQF-SVRRBLITSA-N |
| XLogP | 0.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |