About benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+)
benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+) (PubChem CID 162401470) has the molecular formula C26H23ClN4Pd
and a molecular weight of 533.37 g/mol. Its IUPAC name is benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+).
Molecular Properties
| Compound Name | benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+) |
| PubChem CID | 162401470 |
| Molecular Formula | C26H23ClN4Pd |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+) |
| SMILES | Cl[Pd+].c1ccc(C[N-]c2ccccc2/N=N/c2ccccc2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N4.ClH.Pd/c1-3-11-21(12-4-1)19-27-23-15-7-9-17-25(23)29-30-26-18-10-8-16-24(26)28-20-22-13-5-2-6-14-22;;/h1-18,27H,19-20H2;1H;/q-1;;+2/p-1/b30-29+;; |
| InChIKey | LOGIKEVVQWJGIH-NFOZGECASA-M |
| XLogP | 8.61 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+)?
The IUPAC name of benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+) (CID 162401470) is benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+).
What is the SMILES notation for benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+)?
The canonical SMILES for benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+) is Cl[Pd+].c1ccc(C[N-]c2ccccc2/N=N/c2ccccc2NCc2ccccc2)cc1.
What is the InChIKey of benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+)?
The InChIKey is LOGIKEVVQWJGIH-NFOZGECASA-M. The full InChI is InChI=1S/C26H23N4.ClH.Pd/c1-3-11-21(12-4-1)19-27-23-15-7-9-17-25(23)29-30-26-18-10-8-16-24(26)28-20-22-13-5-2-6-14-22;;/h1-18,27H,19-20H2;1H;/q-1;;+2/p-1/b30-29+;;.
What are the key properties of benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+)?
benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+) has a molecular weight of 533.37 g/mol, XLogP of 8.61, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[2-[[2-(benzylamino)phenyl]diazenyl]phenyl]azanide;chloropalladium(1+) is sourced from PubChem (CID 162401470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).