C28H22F3NO4S — CID 162401608
methyl 8-(4-methylphenyl)sulfonyl-4-phenyl-12-(trifluoromethyl)-8-azatricyclo[7.4.0.03,6]trideca-1(9),2,6,10,12-pentaene-4-carboxylate (PubChem CID 162401608) has the molecular formula C28H22F3NO4S and a molecular weight of 525.55 g/mol. Its IUPAC name is methyl 8-(4-methylphenyl)sulfonyl-4-phenyl-12-(trifluoromethyl)-8-azatricyclo[7.4.0.03,6]trideca-1(9),2,6,10,12-pentaene-4-carboxylate.
| Compound Name | methyl 8-(4-methylphenyl)sulfonyl-4-phenyl-12-(trifluoromethyl)-8-azatricyclo[7.4.0.03,6]trideca-1(9),2,6,10,12-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 162401608 |
| Molecular Formula | C28H22F3NO4S |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | methyl 8-(4-methylphenyl)sulfonyl-4-phenyl-12-(trifluoromethyl)-8-azatricyclo[7.4.0.03,6]trideca-1(9),2,6,10,12-pentaene-4-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)CC2=CN(S(=O)(=O)c3ccc(C)cc3)c3ccc(C(F)(F)F)cc3C=C21 |
| InChI | InChI=1S/C28H22F3NO4S/c1-18-8-11-23(12-9-18)37(34,35)32-17-20-16-27(26(33)36-2,21-6-4-3-5-7-21)24(20)15-19-14-22(28(29,30)31)10-13-25(19)32/h3-15,17H,16H2,1-2H3 |
| InChIKey | JQEZBQYWDGTFLF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |