C27H25NO3 — CID 162401682
methyl (2'R,3R,3'R,5'R)-4-oxo-3',5'-diphenylspiro[1,2-dihydronaphthalene-3,4'-pyrrolidine]-2'-carboxylate (PubChem CID 162401682) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl (2'R,3R,3'R,5'R)-4-oxo-3',5'-diphenylspiro[1,2-dihydronaphthalene-3,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | methyl (2'R,3R,3'R,5'R)-4-oxo-3',5'-diphenylspiro[1,2-dihydronaphthalene-3,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 162401682 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | methyl (2'R,3R,3'R,5'R)-4-oxo-3',5'-diphenylspiro[1,2-dihydronaphthalene-3,4'-pyrrolidine]-2'-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](c2ccccc2)[C@@]2(CCc3ccccc3C2=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H25NO3/c1-31-26(30)23-22(19-11-4-2-5-12-19)27(24(28-23)20-13-6-3-7-14-20)17-16-18-10-8-9-15-21(18)25(27)29/h2-15,22-24,28H,16-17H2,1H3/t22-,23+,24+,27+/m0/s1 |
| InChIKey | RIBRDRFOXUTWCA-ZOJNDGCKSA-N |
| XLogP | 4.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |