About di(phenyl)diazene;bis(yttrium)
di(phenyl)diazene;bis(yttrium) (PubChem CID 162401694) has the molecular formula C12H8N2Y2-2
and a molecular weight of 358.02 g/mol. Its IUPAC name is di(phenyl)diazene;bis(yttrium).
Molecular Properties
| Compound Name | di(phenyl)diazene;bis(yttrium) |
| PubChem CID | 162401694 |
| Molecular Formula | C12H8N2Y2-2 |
| Molecular Weight | 358.02 g/mol |
| Exact Mass | 357.88 |
| IUPAC Name | di(phenyl)diazene;bis(yttrium) |
| SMILES | [Y].[Y].[c-]1ccc(/N=N/c2cc[c-]cc2)cc1 |
| InChI | InChI=1S/C12H8N2.2Y/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;;/h3-10H;;/q-2;;/b14-13+;; |
| InChIKey | HCOVPXQYIJSRKE-QDBORUFSSA-N |
| XLogP | 3.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.02 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze di(phenyl)diazene;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(phenyl)diazene;bis(yttrium)?
The IUPAC name of di(phenyl)diazene;bis(yttrium) (CID 162401694) is di(phenyl)diazene;bis(yttrium).
What is the SMILES notation for di(phenyl)diazene;bis(yttrium)?
The canonical SMILES for di(phenyl)diazene;bis(yttrium) is [Y].[Y].[c-]1ccc(/N=N/c2cc[c-]cc2)cc1.
What is the InChIKey of di(phenyl)diazene;bis(yttrium)?
The InChIKey is HCOVPXQYIJSRKE-QDBORUFSSA-N. The full InChI is InChI=1S/C12H8N2.2Y/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;;/h3-10H;;/q-2;;/b14-13+;;.
What are the key properties of di(phenyl)diazene;bis(yttrium)?
di(phenyl)diazene;bis(yttrium) has a molecular weight of 358.02 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for di(phenyl)diazene;bis(yttrium) is sourced from PubChem (CID 162401694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).