C28H54O5Si2 — CID 162401718
5a,9b-dimethyl-7-triethylsilyloxy-2-(triethylsilyloxymethyl)-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-carboxylic acid (PubChem CID 162401718) has the molecular formula C28H54O5Si2 and a molecular weight of 526.91 g/mol. Its IUPAC name is 5a,9b-dimethyl-7-triethylsilyloxy-2-(triethylsilyloxymethyl)-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-carboxylic acid.
| Compound Name | 5a,9b-dimethyl-7-triethylsilyloxy-2-(triethylsilyloxymethyl)-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-carboxylic acid |
|---|---|
| PubChem CID | 162401718 |
| Molecular Formula | C28H54O5Si2 |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | 5a,9b-dimethyl-7-triethylsilyloxy-2-(triethylsilyloxymethyl)-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-carboxylic acid |
| SMILES | CC[Si](CC)(CC)OCC1CC2(C)C(CCC3(C)C(C(=O)O)C(O[Si](CC)(CC)CC)CCC23)O1 |
| InChI | InChI=1S/C28H54O5Si2/c1-9-34(10-2,11-3)31-20-21-19-28(8)23-16-15-22(33-35(12-4,13-5)14-6)25(26(29)30)27(23,7)18-17-24(28)32-21/h21-25H,9-20H2,1-8H3,(H,29,30) |
| InChIKey | UAVYYVNTWHMPFV-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|