C31H60O5Si2 — CID 162401719
methyl 3-[(6R)-5a,9b-dimethyl-7-triethylsilyloxy-2-(triethylsilyloxymethyl)-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-yl]propanoate (PubChem CID 162401719) has the molecular formula C31H60O5Si2 and a molecular weight of 568.99 g/mol. Its IUPAC name is methyl 3-[(6R)-5a,9b-dimethyl-7-triethylsilyloxy-2-(triethylsilyloxymethyl)-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-yl]propanoate.
| Compound Name | methyl 3-[(6R)-5a,9b-dimethyl-7-triethylsilyloxy-2-(triethylsilyloxymethyl)-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-yl]propanoate |
|---|---|
| PubChem CID | 162401719 |
| Molecular Formula | C31H60O5Si2 |
| Molecular Weight | 568.99 g/mol |
| Exact Mass | 568.40 |
| IUPAC Name | methyl 3-[(6R)-5a,9b-dimethyl-7-triethylsilyloxy-2-(triethylsilyloxymethyl)-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-yl]propanoate |
| SMILES | CC[Si](CC)(CC)OCC1CC2(C)C(CCC3(C)C2CCC(O[Si](CC)(CC)CC)[C@@H]3CCC(=O)OC)O1 |
| InChI | InChI=1S/C31H60O5Si2/c1-10-37(11-2,12-3)34-23-24-22-31(8)27-18-17-26(36-38(13-4,14-5)15-6)25(16-19-29(32)33-9)30(27,7)21-20-28(31)35-24/h24-28H,10-23H2,1-9H3/t24?,25-,26?,27?,28?,30?,31?/m0/s1 |
| InChIKey | QQNMNTXXRNOAQD-WFKYZTNKSA-N |
| XLogP | 8.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.99 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|