C10H19NO — CID 162401737
N-[(1S,2R)-2-methylcycloheptyl]acetamide (PubChem CID 162401737) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcycloheptyl]acetamide.
| Compound Name | N-[(1S,2R)-2-methylcycloheptyl]acetamide |
|---|---|
| PubChem CID | 162401737 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-[(1S,2R)-2-methylcycloheptyl]acetamide |
| SMILES | CC(=O)N[C@H]1CCCCC[C@H]1C |
| InChI | InChI=1S/C10H19NO/c1-8-6-4-3-5-7-10(8)11-9(2)12/h8,10H,3-7H2,1-2H3,(H,11,12)/t8-,10+/m1/s1 |
| InChIKey | FWKFAUDSPHNKNT-SCZZXKLOSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |