C13H14F6O2 — CID 162401751
3,3-bis(2,2,2-trifluoroethoxy)propylbenzene (PubChem CID 162401751) has the molecular formula C13H14F6O2 and a molecular weight of 316.24 g/mol. Its IUPAC name is 3,3-bis(2,2,2-trifluoroethoxy)propylbenzene.
| Compound Name | 3,3-bis(2,2,2-trifluoroethoxy)propylbenzene |
|---|---|
| PubChem CID | 162401751 |
| Molecular Formula | C13H14F6O2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3,3-bis(2,2,2-trifluoroethoxy)propylbenzene |
| SMILES | FC(F)(F)COC(CCc1ccccc1)OCC(F)(F)F |
| InChI | InChI=1S/C13H14F6O2/c14-12(15,16)8-20-11(21-9-13(17,18)19)7-6-10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | MFHAYGFSRVZESP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|