C17H20O3 — CID 162401783
(10S)-spiro[1,2,3,4,5,6,7,8-octahydrophenanthrene-10,5'-oxolane]-2',9-dione (PubChem CID 162401783) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (10S)-spiro[1,2,3,4,5,6,7,8-octahydrophenanthrene-10,5'-oxolane]-2',9-dione.
| Compound Name | (10S)-spiro[1,2,3,4,5,6,7,8-octahydrophenanthrene-10,5'-oxolane]-2',9-dione |
|---|---|
| PubChem CID | 162401783 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (10S)-spiro[1,2,3,4,5,6,7,8-octahydrophenanthrene-10,5'-oxolane]-2',9-dione |
| SMILES | O=C1CC[C@@]2(O1)C(=O)C1=C(CCCC1)C1=C2CCCC1 |
| InChI | InChI=1S/C17H20O3/c18-15-9-10-17(20-15)14-8-4-3-6-12(14)11-5-1-2-7-13(11)16(17)19/h1-10H2/t17-/m0/s1 |
| InChIKey | WNSYCDFLYVXQBS-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |